Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
| CAS | 10024-93-8 |
|---|---|
| MDL Number | MFCD00011132 |
Cobalt(II) chloride, ultra dry, 99.998% (metals basis)
CAS: 7646-79-9 Molecular Formula: Cl2Co Molecular Weight (g/mol): 129.83 MDL Number: MFCD00010938 InChI Key: GVPFVAHMJGGAJG-UHFFFAOYSA-L Synonym: cobalt ii chloride,cobaltchloride,cobalt chloride 0.1 m solution,cobalt ii chloride, anhydrous,cobalt ii-chloride,curator_000013,cobalt chloride anhydrous,wln: co g2,cobalt-ii-chloride IUPAC Name: λ²-cobalt(2+) dichloride SMILES: [Cl-].[Cl-].[Co++]
| CAS | 7646-79-9 |
|---|---|
| Molecular Weight (g/mol) | 129.83 |
| MDL Number | MFCD00010938 |
| SMILES | [Cl-].[Cl-].[Co++] |
| Synonym | cobalt ii chloride,cobaltchloride,cobalt chloride 0.1 m solution,cobalt ii chloride, anhydrous,cobalt ii-chloride,curator_000013,cobalt chloride anhydrous,wln: co g2,cobalt-ii-chloride |
| IUPAC Name | λ²-cobalt(2+) dichloride |
| InChI Key | GVPFVAHMJGGAJG-UHFFFAOYSA-L |
| Molecular Formula | Cl2Co |
Ytterbium foil, 0.64mm (0.025in) thick, 99.9% (REO)
CAS: 7440-64-4 Molecular Formula: Yb Molecular Weight (g/mol): 173.05 MDL Number: MFCD00011286 InChI Key: NAWDYIZEMPQZHO-UHFFFAOYSA-N Synonym: unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n PubChem CID: 23992 ChEBI: CHEBI:33381 IUPAC Name: ytterbium SMILES: [Yb]
| PubChem CID | 23992 |
|---|---|
| CAS | 7440-64-4 |
| Molecular Weight (g/mol) | 173.05 |
| ChEBI | CHEBI:33381 |
| MDL Number | MFCD00011286 |
| SMILES | [Yb] |
| Synonym | unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n |
| IUPAC Name | ytterbium |
| InChI Key | NAWDYIZEMPQZHO-UHFFFAOYSA-N |
| Molecular Formula | Yb |
Manganese(IV) oxide, 80-85%, powder
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Sodium bisulfate, 92%, technical
CAS: 7681-38-1 Molecular Formula: HNaO4S Molecular Weight (g/mol): 120.05 MDL Number: MFCD00003531 InChI Key: WBHQBSYUUJJSRZ-UHFFFAOYSA-M Synonym: sodium hydrogen sulfate,sodium bisulfate,sodium acid sulfate,bisulfate of soda,sodium hydrosulfate,fanal,sodium hydrogensulphate,niter cake,nitre cake,wc-perfect PubChem CID: 516919 IUPAC Name: sodium hydrogen sulfate SMILES: [Na+].OS([O-])(=O)=O
| PubChem CID | 516919 |
|---|---|
| CAS | 7681-38-1 |
| Molecular Weight (g/mol) | 120.05 |
| MDL Number | MFCD00003531 |
| SMILES | [Na+].OS([O-])(=O)=O |
| Synonym | sodium hydrogen sulfate,sodium bisulfate,sodium acid sulfate,bisulfate of soda,sodium hydrosulfate,fanal,sodium hydrogensulphate,niter cake,nitre cake,wc-perfect |
| IUPAC Name | sodium hydrogen sulfate |
| InChI Key | WBHQBSYUUJJSRZ-UHFFFAOYSA-M |
| Molecular Formula | HNaO4S |
Tetraammineplatinum(II) chloride monohydrate
CAS: 13933-33-0 Molecular Formula: Cl2H14N4OPt Molecular Weight (g/mol): 352.12 MDL Number: MFCD00149947 InChI Key: GWBDNMCYHWRSOH-UHFFFAOYSA-L Synonym: azane;platinum 2+ ;dichloride;hydrate,tetrammineplatinum ii chloride hydrate,tetraammineplatinum ii chloride monohydrate,platinum 2+ ion tetraamine hydrate dichloride,platinum 2+ tetraamine hydrate dichloride,platinum 2+ chloride-ammonia-water 1/2/4/1,tetraamineplatinium ii chloride PubChem CID: 21946612 IUPAC Name: azane;platinum(2+);dichloride;hydrate SMILES: N.N.N.N.O.[Cl-].[Cl-].[Pt++]
| PubChem CID | 21946612 |
|---|---|
| CAS | 13933-33-0 |
| Molecular Weight (g/mol) | 352.12 |
| MDL Number | MFCD00149947 |
| SMILES | N.N.N.N.O.[Cl-].[Cl-].[Pt++] |
| Synonym | azane;platinum 2+ ;dichloride;hydrate,tetrammineplatinum ii chloride hydrate,tetraammineplatinum ii chloride monohydrate,platinum 2+ ion tetraamine hydrate dichloride,platinum 2+ tetraamine hydrate dichloride,platinum 2+ chloride-ammonia-water 1/2/4/1,tetraamineplatinium ii chloride |
| IUPAC Name | azane;platinum(2+);dichloride;hydrate |
| InChI Key | GWBDNMCYHWRSOH-UHFFFAOYSA-L |
| Molecular Formula | Cl2H14N4OPt |
Tungsten slug, 17.5mm (0.689in) dia x 6.4mm (0.25in) length, 99.9% (metals basis)
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Adenosine-5'-Diphosphate Disodium Salt Dihydrate
CAS: 16178-48-6 Molecular Formula: C10H13N5Na2O10P2 Molecular Weight (g/mol): 471.17 MDL Number: MFCD00150927 InChI Key: ORKSTPSQHZNDSC-WCYUCLFNNA-L Synonym: adenosine 5 '-diphosphate disodium salt,adenosine-5 '-diphosphate disodium salt,sodium 2 r,3 s,4 r,5 r-5-6-amino-9 h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl hydrogendiphosphate,adenosine 5 '-diphosphate disodium salt hydrate,adenosine, 5 '-diphosphoric acid, disodium salt,adenosine 5'-trihydrogen diphosphate , disodium salt,trinosin s hydrate,disodium hydrogen 2r,3s,4r,5r-5-6-aminopurin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxyphosphonate,adenosine 5'-trihydrogen diphosphate , sodium salt 1:2,disodium adp hydrate PubChem CID: 85315 SMILES: [Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP([O-])(=O)OP(O)([O-])=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 85315 |
|---|---|
| CAS | 16178-48-6 |
| Molecular Weight (g/mol) | 471.17 |
| MDL Number | MFCD00150927 |
| SMILES | [Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP([O-])(=O)OP(O)([O-])=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | adenosine 5 '-diphosphate disodium salt,adenosine-5 '-diphosphate disodium salt,sodium 2 r,3 s,4 r,5 r-5-6-amino-9 h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl hydrogendiphosphate,adenosine 5 '-diphosphate disodium salt hydrate,adenosine, 5 '-diphosphoric acid, disodium salt,adenosine 5'-trihydrogen diphosphate , disodium salt,trinosin s hydrate,disodium hydrogen 2r,3s,4r,5r-5-6-aminopurin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxyphosphonate,adenosine 5'-trihydrogen diphosphate , sodium salt 1:2,disodium adp hydrate |
| InChI Key | ORKSTPSQHZNDSC-WCYUCLFNNA-L |
| Molecular Formula | C10H13N5Na2O10P2 |
Zirconium oxide, catalyst support, Thermo Scientific Chemicals
MDL Number: MFCD00011310
| MDL Number | MFCD00011310 |
|---|
| MDL Number | MFCD08064551 |
|---|---|
| Color | Amber |
| Physical Form | Liquid |
| DOT Information | DOT Class: 8, Packaging Group: III |
| Chemical Name or Material | Molybdenum etchant |
Zinc telluride, 99.99% (metals basis)
CAS: 1315-11-3 Molecular Formula: TeZn Molecular Weight (g/mol): 192.98 MDL Number: MFCD00043079 InChI Key: NSRBDSZKIKAZHT-UHFFFAOYSA-N Synonym: zinc telluride,zinc telluride znte,unii-ir8eb6g3vq,zinktellurid,ir8eb6g3vq,zinc telluride,-100 mesh trace metals basis PubChem CID: 3362486 IUPAC Name: tellanylidenezinc SMILES: [Zn]=[Te]
| PubChem CID | 3362486 |
|---|---|
| CAS | 1315-11-3 |
| Molecular Weight (g/mol) | 192.98 |
| MDL Number | MFCD00043079 |
| SMILES | [Zn]=[Te] |
| Synonym | zinc telluride,zinc telluride znte,unii-ir8eb6g3vq,zinktellurid,ir8eb6g3vq,zinc telluride,-100 mesh trace metals basis |
| IUPAC Name | tellanylidenezinc |
| InChI Key | NSRBDSZKIKAZHT-UHFFFAOYSA-N |
| Molecular Formula | TeZn |
Cerium(III) bromide hydrate, 99%
CAS: 14457-87-5 Molecular Formula: Br3Ce Molecular Weight (g/mol): 379.83 MDL Number: MFCD00016004 InChI Key: MOOUSOJAOQPDEH-UHFFFAOYSA-K IUPAC Name: cerium(3+) tribromide SMILES: [Br-].[Br-].[Br-].[Ce+3]
| CAS | 14457-87-5 |
|---|---|
| Molecular Weight (g/mol) | 379.83 |
| MDL Number | MFCD00016004 |
| SMILES | [Br-].[Br-].[Br-].[Ce+3] |
| IUPAC Name | cerium(3+) tribromide |
| InChI Key | MOOUSOJAOQPDEH-UHFFFAOYSA-K |
| Molecular Formula | Br3Ce |
Cupric Nitrate Hydrate, MP Biomedicals
CAS: 10031-43-3 Molecular Formula: CuH6N2O9 Molecular Weight (g/mol): 241.599 InChI Key: SXTLQDJHRPXDSB-UHFFFAOYSA-N Synonym: copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem PubChem CID: 9837674 IUPAC Name: copper;dinitrate;trihydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2]
| PubChem CID | 9837674 |
|---|---|
| CAS | 10031-43-3 |
| Molecular Weight (g/mol) | 241.599 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2] |
| Synonym | copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem |
| IUPAC Name | copper;dinitrate;trihydrate |
| InChI Key | SXTLQDJHRPXDSB-UHFFFAOYSA-N |
| Molecular Formula | CuH6N2O9 |
Calcium D-saccharate tetrahydrate, 98%
CAS: 5793-89-5 Molecular Formula: C6H16CaO12 Molecular Weight (g/mol): 320.26 MDL Number: MFCD00150704 InChI Key: ZQWFSIZRQANUDA-WQMSYZFBSA-L Synonym: calcium saccharate,unii-6ap9j91k4v,d-saccharic acid calcium salt tetrahydrate,calcium d-glucarate tetrahydrate,calcium d-saccharate tetrahydrate,calcium saccharat-4-wasser,calcium saccharate usan:usp:inn,calcium saccharate usp,calcium d-glucarate, tetrahydrate,calcium d-glucarate 1:1 , tetrahydrate PubChem CID: 16211545 IUPAC Name: calcium;(2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate;tetrahydrate SMILES: C(C(C(C(=O)[O-])O)O)(C(C(=O)[O-])O)O.O.O.O.O.[Ca+2]
| PubChem CID | 16211545 |
|---|---|
| CAS | 5793-89-5 |
| Molecular Weight (g/mol) | 320.26 |
| MDL Number | MFCD00150704 |
| SMILES | C(C(C(C(=O)[O-])O)O)(C(C(=O)[O-])O)O.O.O.O.O.[Ca+2] |
| Synonym | calcium saccharate,unii-6ap9j91k4v,d-saccharic acid calcium salt tetrahydrate,calcium d-glucarate tetrahydrate,calcium d-saccharate tetrahydrate,calcium saccharat-4-wasser,calcium saccharate usan:usp:inn,calcium saccharate usp,calcium d-glucarate, tetrahydrate,calcium d-glucarate 1:1 , tetrahydrate |
| IUPAC Name | calcium;(2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate;tetrahydrate |
| InChI Key | ZQWFSIZRQANUDA-WQMSYZFBSA-L |
| Molecular Formula | C6H16CaO12 |
Ammonium hexafluorophosphate, 99%, pure
CAS: 16941-11-0 Molecular Formula: H4F6NP Molecular Weight (g/mol): 163 MDL Number: MFCD00064642 InChI Key: NIZXKAYXSNUDOU-UHFFFAOYSA-O Synonym: ammonium hexafluorophosphate,ammonium hexafluorophosphate v,ammonium hexafluophosphate,ammoniumhexafluorophosphate 6ci,7ci,unii-ns308031pj,azanium hexafluorophosphate,nh4pf6,ksc492g2j,ammonium hexafluoro-,e5-phosphanuide,ammonium phosphorus hexafluoride PubChem CID: 9793912 IUPAC Name: azanium;hexafluorophosphate SMILES: [NH4+].F[P-](F)(F)(F)(F)F
| PubChem CID | 9793912 |
|---|---|
| CAS | 16941-11-0 |
| Molecular Weight (g/mol) | 163 |
| MDL Number | MFCD00064642 |
| SMILES | [NH4+].F[P-](F)(F)(F)(F)F |
| Synonym | ammonium hexafluorophosphate,ammonium hexafluorophosphate v,ammonium hexafluophosphate,ammoniumhexafluorophosphate 6ci,7ci,unii-ns308031pj,azanium hexafluorophosphate,nh4pf6,ksc492g2j,ammonium hexafluoro-,e5-phosphanuide,ammonium phosphorus hexafluoride |
| IUPAC Name | azanium;hexafluorophosphate |
| InChI Key | NIZXKAYXSNUDOU-UHFFFAOYSA-O |
| Molecular Formula | H4F6NP |